This compound is a chemical compound with a pyrrolidine ring and a tert-butoxycarbonyl (Boc) protecting group, commonly employed as a pharmaceutical intermediate. Its structure features a stereocenter, making it useful in the synthesis of enantiomerically pure compounds for drug development.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 122536-76-9
3-(boc-amino)piperidine
Pharmaceutical intermediate
Tert-butyl N-[(3S)-piperidin-3-yl]carbamate
pharmaceutical intermediate
(3R)-3-Aminopiperidine, 3-BOC protected
Pharmaceutical intermediate for API synthesis
Tert-butyl N-[(3R)-piperidin-3-yl]carbamate hydrochloride
research compound
(S)-3-Hydroxypyrrolidine hydrochloride
Pharmaceutical intermediate
4,4-Difluorocyclohexanecarboxylic acid
Pharmaceutical intermediate synthesis
1-tert-butyl 3-methyl pyrrolidine-1,3-dicarboxylate
Pharmaceutical intermediate
N-(tert-Butoxycarbonyl)-N'-methylethylenediamine
Pharmaceutical intermediate
tert-butyl N-[(3S)-pyrrolidin-3-yl]carbamate
DQQJBEAXSOOCPG-ZETCQYMHSA-N
CC(C)(C)OC(=O)N[C@H]1CCNC1