Methyl 5-Bromo-2-methoxynicotinate is a chemical compound used primarily as a research reagent. It is a functionalized pyridine derivative bearing ester, ether, and halogen groups, commonly employed in laboratory-scale organic synthesis and medicinal chemistry studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 122433-41-4
5-bromo-2-methoxypyridine-3-carboxylic acid
heterocyclic organic acid research compound
Cyclooctene;iridium;dichloride
organoiridium catalyst precursor
(2S)-2-((2-(2-(2-(2-(2-(2-(2-(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethylamino)-2-oxoethoxy)acetyl)amino)-N-(4-(hydroxymethyl)phenyl)-6-(((4-methoxyphenyl)-diphenylmethyl)amino)hexanamide
PEGylated bifunctional linker reagent
(9,9-Diphenyl-9H-fluoren-4-yl)boronic acid
research compound
6-chloro-5-fluoro-1H-indole
research compound
methyl 5-bromo-2-methoxypyridine-3-carboxylate
OLQOVEOEHQDKSC-UHFFFAOYSA-N
COC1=C(C=C(C=N1)Br)C(=O)OC
—