PBD dimer is a research compound belonging to the pyrrolobenzodiazepine family. It is a large, complex molecule with multiple aromatic rings and ether linkages, used primarily in laboratory settings for scientific investigation.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1222490-34-7
6-Bromo-3-pyridinemethanol
research compound
(S)-N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-C-ALPHA-METHYL-2,6-DIFLUOROPHENYLALANINE
Fmoc-protected amino acid for peptide synthesis
2'-guanylic acid
ribonuclease T1 inhibitor
(4-(benzyloxy)-3,5-difluorophenyl)methanol
research compound
(2S)-N-[(2S)-1-[4-[(6aS)-3-[3-[[(6aS)-2-methoxy-8-(4-methoxyphenyl)-11-oxo-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]propoxy]-2-methoxy-11-oxo-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepin-8-yl]anilino]-1-oxopropan-2-yl]-2-amino-3-methylbutanamide
antibody-drug conjugate payload
(6aS)-3-[3-[[(6aS)-2-methoxy-8-(4-methoxyphenyl)-11-oxo-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]propoxy]-8-(4-aminophenyl)-2-methoxy-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepin-11-one
OMRPLUKQNWNZAV-CONSDPRKSA-N
COC1=CC=C(C=C1)C2=CN3[C@@H](C2)C=NC4=CC(=C(C=C4C3=O)OC)OCCCOC5=C(C=C6C(=C5)N=C[C@@H]7CC(=CN7C6=O)C8=CC=C(C=C8)N)OC