This compound is a carbamate derivative featuring a fluorenylmethyl group and a pyrrolidine ring. It is typically employed as a research reagent in chemical and biochemical studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1217635-77-2
9H-fluoren-9-ylmethyl N-[(3R)-piperidin-3-yl]carbamate
research compound
(9H-Fluoren-9-yl)methyl piperidin-3-ylcarbamate--hydrogen chloride (1/1)
Fmoc-protected piperidine intermediate
Tert-butyl N-[(3R)-piperidin-3-yl]carbamate hydrochloride
research compound
(-)-Epicatechin-13C3
pharmaceutical reference standard
Aflatoxin B2-d3
Deuterated analytical reference standard
D-Cyclopropylalanine
research compound
(R)-3-(Fmoc-amino)pyrrolidine HCl
Chiral building block for pharma synthesis
(4S)-4-N-Fmoc-amino-1-Boc-L-proline
Protected amino acid for peptide synthesis
9H-fluoren-9-ylmethyl N-[(3S)-pyrrolidin-3-yl]carbamate
QWZBVHPYOLIGBQ-ZDUSSCGKSA-N
C1CNC[C@H]1NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
—