Hydroxychloroquine-d4 Sulfate is a deuterium-labeled research compound, structurally based on hydroxychloroquine where four hydrogen atoms are replaced with deuterium. It is primarily used as an internal standard or tracer in analytical and pharmaceutical research studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1216432-56-2
4-OHPropranolol-d7 HCl
Deuterium-labeled research compound
2,6-DICHLOROANILINE-3,4,5-D3
Deuterium-labeled research compound
Zolpidem Phenyl-4-carboxylic Acid Ethyl Ester-d6
research compound
N-Methyl-beta-alanine-d3
deuterated research compound
1-ethyl-6-fluoro-7-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid
research compound
(+/-)-linalool-d3
deuterated analytical standard
Hydroxychloroquinsulfat
active pharmaceutical ingredient
Hydroxychloroquin
active pharmaceutical ingredient
2-[[4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentyl]-ethylamino]ethanol;sulfuric acid
JCBIVZZPXRZKTI-LINVOLBQSA-N
[2H]C([2H])(CC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)C([2H])([2H])N(CC)CCO.OS(=O)(=O)O