DPPF (1,1'-bis(diphenylphosphino)ferrocene) is a research reagent primarily used as an ionophore in chemical sensing applications. Its structure features a ferrocene backbone with two diphenylphosphino groups, enabling selective ion binding and detection.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 12150-46-8
(1,1'-Bis(diphenylphosphino)ferrocene)dichloropalladium
palladium catalyst for cross-coupling reactions
[1,1'-Bis(diphenylphosphino)ferrocene]palladium(II) chloride dichloromethane complex
Cross-coupling catalyst in organic synthesis
(r)-4-(trimethylsilyl)-3-butyn-2-ol
research chemical
Midazolam 2,5-Dioxide-d6
deuterated analytical reference standard
N-Acetyl Sulfamethoxazole-d4 (major)
Research compound for metabolite analysis
Zolpidem-d6 6-Carboxylic Acid Methyl Ester
research compound
bis(cyclopenta-1,4-dien-1-yl(diphenyl)phosphane);iron(2+)
KZPYGQFFRCFCPP-UHFFFAOYSA-N
[CH-]1C=CC(=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.[CH-]1C=CC(=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.[Fe+2]