This compound is a boronic acid derivative used primarily as an intermediate in organic synthesis, particularly in the construction of complex molecular architectures. Its structure features a brominated fluorene core, which imparts specific reactivity for cross-coupling reactions.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1213768-48-9
2'-Hydroxychalcone
research compound
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-naphtho[1,8-de][1,3,2]diazaborinine
Boron reagent for cross-coupling
Methyl 5-bromo-3-(trifluoromethyl)pyridine-2-carboxylate
Research chemical intermediate
Methyl 5-bromo-6-methoxypicolinate
research compound
(7-bromo-9,9-dimethylfluoren-2-yl)boronic acid
CYZUULREWZKGJP-UHFFFAOYSA-N
B(C1=CC2=C(C=C1)C3=C(C2(C)C)C=C(C=C3)Br)(O)O
—