6-Bromo-5-(trifluoromethyl)pyridin-3-ol is a research compound featuring a pyridine ring with bromine and trifluoromethyl substituents. Its structure includes an aromatic heterocycle and halogen groups, making it of interest for synthetic chemistry studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1211539-16-0
5-Hydroxy-3-(trifluoromethyl)picolinic acid
research chemical intermediate
5-bromo-3-(trifluoromethyl)pyridine-2-carboxylic acid
research compound
Methyl 5-hydroxy-3-(trifluoromethyl)picolinate
research compound
3-BROMO-2-CHLORO-5-IODOPYRIDINE
Research reagent for organic synthesis
6-bromo-5-(trifluoromethyl)pyridin-3-ol
GEODJYNOFUSNSI-UHFFFAOYSA-N
C1=C(C=NC(=C1C(F)(F)F)Br)O
—