Z944 is a compound used as a T-type calcium channel blocker in pharmaceutical research. Its structure features multiple amide groups and a halogen-substituted aromatic ring, contributing to its receptor-targeting properties.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1199236-64-0
Ertapenem N-Carbonyl Dimer Impurity
Pharmaceutical impurity reference standard
Benzoesäurebenzylester
scabicide and insect repellent
(R)-Liponsäure
nutritional supplement active ingredient
7-(4-chlorobutoxy)-3,4-dihydro-2(1H)-quinolinone
pharmaceutical impurity reference standard
4-Amino-5-chloro-2-methoxy-N-(piperidin-4-ylmethyl)benzamide hydrochloride
research compound
N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3-chloro-5-fluorobenzamide
JOCLITFYIMJMNK-UHFFFAOYSA-N
CC(C)(C)NC(=O)CN1CCC(CC1)CNC(=O)C2=CC(=CC(=C2)Cl)F