This compound is a chloroformate derivative of a tetrahydroisoquinoline, characterized by a single chiral center. It is typically used as a research reagent for the synthesis of more complex molecules in medicinal chemistry studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1195949-26-8
9-([1,1'-Biphenyl]-4-yl)-10-bromo-2-phenylanthracene
Organic electronic material intermediate
3,4-dihydroisoquinolin-1(2H)-one
research compound
2-chloro-6-(trifluoromethyl)isonicotinonitrile
pharmaceutical intermediate
5'-ODMT cEt N-Bz A Phosphoramidite (Amidite)
DNA oligonucleotide synthesis reagent
Ethyl (1S)-1-phenyl-3,4-dihydroisoquinoline-2(1H)-carboxylate
pharmaceutical intermediate
(1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline
pharmaceutical intermediate
(1S)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbonyl chloride
RRAXMPIDJONJNT-HNNXBMFYSA-N
C1CN([C@H](C2=CC=CC=C21)C3=CC=CC=C3)C(=O)Cl
—