4-Methyl-3-nitroaniline is an organic compound used primarily as a dye intermediate. Its structure features an aromatic ring substituted with an amino group, a nitro group, and a methyl group, contributing to its use in the synthesis of various dyes and pigments.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 119-32-4
4-Hydroxy-7-(phenylamino)naphthalene-2-sulfonic acid
dye intermediate for azo dyes
5-Amino-2-[(4-aminophenyl)amino]benzenesulfonic acid
dye intermediate
4-Nitro-4'-aminostilbene-2,2'-disulfonic acid
stilbene dye intermediate
5-amino-2-[(E)-2-[4-(3-methyl-5-oxo-4H-pyrazol-1-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid
dye intermediate
4-methyl-3-nitroaniline
GDIIPKWHAQGCJF-UHFFFAOYSA-N
CC1=C(C=C(C=C1)N)[N+](=O)[O-]