Pteroic acid is a chemical compound that serves as a direct precursor in the biosynthesis of folic acid. It consists of a pterin ring system linked to a 4-aminobenzoic acid moiety, containing both aromatic and heterocyclic structures with carboxylic acid and amine functional groups.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 119-24-4
L-Homocitrulline
research compound
N-Acetylcysteamine
research reagent
[(2R)-pyrrolidin-2-yl]methanamine dihydrochloride
research compound
Methyl 6-chloro-2-oxo-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate
research compound
Folic acid
Vitamin nutritional factor
Folic acid dihydrate
active pharmaceutical ingredient
N-Nitrosofolic acid
nitrosamine impurity standard for folic acid
N2-(4-(((2-Amino-4-oxo-4,8-dihydropteridin-6-yl)methyl)amino)benzoyl)-N5-(2-(2-(2-azidoethoxy)ethoxy)ethyl)-L-glutamine
PEGylated folate probe for click chemistry
4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoic acid
JOAQINSXLLMRCV-UHFFFAOYSA-N
C1=CC(=CC=C1C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N