Acetic acid-d4 is a deuterated form of acetic acid where all hydrogen atoms are replaced by deuterium. It is primarily used as a solvent in nuclear magnetic resonance (NMR) spectroscopy due to its minimal interference with proton NMR signals.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1186-52-3
Methanol-d
NMR solvent
(2H6)Ethanol
NMR solvent
Methylene chloride-D2
NMR solvent
Octadeuterotetrahydrofuran
NMR solvent
N-(5-((4-((4-ethylpiperazin-1-yl)methyl)-3-(trifluoromethyl)phenyl)carbamoyl)-2-methylphenyl)-5-(thiophen-2-yl)pyridine-3-carboxamide (6)
research compound
2-(4-bromophenyl)-5-phenylthiophene
Research reagent for organic synthesis
Butyl (S)-oxirane-2-carboxylate
research compound
5-Chlorobiphenyl-3-ylboronic acid
Suzuki coupling reagent
deuterio 2,2,2-trideuterioacetate
QTBSBXVTEAMEQO-GUEYOVJQSA-N
[2H]C([2H])([2H])C(=O)O[2H]