This compound is a research reagent featuring a urea-linked pyrazole structure with tert-butyl, methylphenyl, and pyridin-3-yloxymethyl substituents. It is primarily used in laboratory research as a chemical tool for studying biological or chemical systems.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1166393-85-6
Ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]acetate
boronic ester research compound
6-Chloropyrazolo[1,5-a]pyridine-3-carboxylic acid
research compound
Methyl 4-chloropyrazolo[1,5-a]pyridine-3-carboxylate
research compound
4-Chloropyrazolo[1,5-a]pyridine-3-carboxylic acid
Research reagent for chemical synthesis
1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[5-(pyridin-3-yloxymethyl)-1H-pyrazol-3-yl]urea
NJARPUHZDSAXPL-UHFFFAOYSA-N
CC1=CC=C(C=C1)N2C(=CC(=N2)C(C)(C)C)NC(=O)NC3=NNC(=C3)COC4=CN=CC=C4