NOTA-bis(tBu)ester is a research reagent derived from the NOTA (1,4,7-triazacyclononane-1,4,7-triacetic acid) chelator platform. It features two tert-butyl ester protecting groups and is primarily used in laboratory settings for the synthesis of bifunctional chelating agents or radiolabeling precursors.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1161415-28-6
Tri-tert-butyl 1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetate
protected macrocyclic chelating agent
12(S)-HEPE
assay reference standard
(3R)-pyrrolidin-3-amine
chiral amine research building block
Tert-butyl (3S,4S)-4-amino-3-hydroxypiperidine-1-carboxylate
research compound
2,5-Diiodopyridine
Research reagent
(R)-NODAGA-tris(t-Bu ester)
chelating agent intermediate for bioconjugation
(S)-4-(4,7-Bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)-5-(tert-butoxy)-5-oxopentanoic acid
research reagent
1,4,7-Triazacyclononane
crown amine ligand for coordination chemistry
2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7-triazonan-1-yl]acetic acid
UACSRZWSADEYPK-UHFFFAOYSA-N
CC(C)(C)OC(=O)CN1CCN(CCN(CC1)CC(=O)OC(C)(C)C)CC(=O)O