4-Fluoro-3-nitropyridine is a fluorinated nitropyridine compound used primarily as an intermediate in organic synthesis. Its chemical structure features both a fluorine atom and a nitro group on a pyridine ring, giving it reactivity suitable for constructing more complex molecules in research and development.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 115812-96-9
N-Nitroso DL-Praziquanamine
Nitrosamine impurity reference standard
4-AMINO-2-BROMO-6-CHLOROPHENOL
Research compound
ME-DMAE-NHS
chemiluminescent label reagent
Sodium 2-(3,7-bis(dimethylamino)-10H-phenothiazine-10-carboxamido)acetate
research compound
4-fluoro-3-nitropyridine
ITEDEJJEXBFZGM-UHFFFAOYSA-N
C1=CN=CC(=C1F)[N+](=O)[O-]