2-amino-4'-bromobenzophenone is an organic compound that serves as a pharmaceutical intermediate. It contains an amine group, two aromatic rings, and a bromine substituent, contributing to its role in chemical synthesis.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1140-17-6
3-bromo-5,7-dichloropyrazolo[1,5-a]pyrimidine
pharmaceutical intermediate
(S)-Methyl 2-((S)-4-Methyl-2-((S)-2-(2-MorpholinoacetaMido)-4-phenylbutanaMido)pentanaMido)-3-phenylpropanoate
Pharmaceutical intermediate for carfilzomib synthesis
Tert-butyl (3s,4r)-4-(aminomethyl)-3-hydroxypiperidine-1-carboxylate
Pharmaceutical intermediate
2,3,6-Trifluorophenylacetic acid
pharmaceutical intermediate
(2-aminophenyl)-(4-bromophenyl)methanone
WIISOMGJWLLMDG-UHFFFAOYSA-N
C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)Br)N