This compound is a deuterium-labeled derivative of piperazine, specifically designed for research applications. Its primary significance is as a stable isotope-labeled reagent used in analytical and biochemical studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1126621-86-0
8-Hydroxyquinoline 1-oxide
research compound
2,4-Dichloro-6-(naphthalen-2-yl)-1,3,5-triazine
research compound
(1R)-1-(3-chlorophenyl)propan-1-ol
chiral research compound
3-Fluoro-4-methoxyphenylmagnesium bromide
Grignard reagent for organic synthesis
1-Boc-piperazine
protecting group for piperazine synthesis
Tert-butyl Piperazine-1-carboxylate Hydrochloride
Pharmaceutical intermediate for drug synthesis
tert-butyl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate
CWXPZXBSDSIRCS-DUSUNJSHSA-N
[2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C(=O)OC(C)(C)C)([2H])[2H])[2H]