Oleoyl chloride is a chemical compound used primarily as a pharmaceutical intermediate in the synthesis of other compounds. It is an acyl chloride derived from oleic acid, characterized by a long hydrocarbon chain and a reactive chlorocarbonyl group.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 112-77-6
Nonanoyl chloride
Acylating agent for chemical synthesis
(2R)-2-(((2R)-1-(Bis(4-methoxyphenyl)(phenyl)methoxy)-3-(((2-cyanoethoxy)(diisopropylamino)phosphino)oxy)propan-2-yl)oxy)-2-(2-isobutyramido-6-oxo-3H-purin-9(6H)-yl)ethyl benzoate
nucleoside phosphoramidite building block
(S)-tetrahydrofuran-3-yl 4-methylbenzenesulfonate
Chiral intermediate for pharmaceutical synthesis
(S)-(-)-alpha,alpha-Diphenyl-2-pyrrolidinemethanol
pharmaceutical intermediate
4-methylpyridin-3-ol
Pharmaceutical intermediate
(Z)-octadec-9-enoyl chloride
MLQBTMWHIOYKKC-KTKRTIGZSA-N
CCCCCCCC/C=C\CCCCCCCC(=O)Cl