This compound is an imidazolium chloride salt that serves as a precursor for N-heterocyclic carbenes (NHCs). It is primarily used as a ligand in coordination chemistry and catalysis research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1118916-80-5
6-Heptenoic acid
chemical intermediate for synthesis
3,3'-Dithiodipropionic acid
Research reagent
1-tert-Butyl 20-(2,5-dioxopyrrolidin-1-yl) icosanedioate
research compound for PEGylation
2,3-Difluoro-5-nitrophenol
Research chemical for synthesis
1,3-Bis(2,6-di(pentan-3-yl)phenyl)-1H-imidazol-3-ium chloride
research compound for organic synthesis
4,5-dimethyl-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium chloride
DJVXHXYBTVBZMP-UHFFFAOYSA-M
CC1=CC(=C(C(=C1)C)N2C=[N+](C(=C2C)C)C3=C(C=C(C=C3C)C)C)C.[Cl-]
—