5,12-Naphthacenequinone is a tetracenequinone compound that serves as a quinone intermediate in the production of dyes and pigments.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1090-13-7
1-ethoxycarbonyl-1,1-difluoro-2-butyl methacrylate
monomer for polymer synthesis
Tert-Butyl 2,2-difluoro-3-(methacryloyloxy)pentanoate
Industrial chemical intermediate
FURAN
Chemical intermediate for tetrahydrofuran synthesis
Di-tert-butyl peroxide
Polymerization catalyst and cross-linking agent
tetracene-5,12-dione
LZPBKINTWROMEA-UHFFFAOYSA-N
C1=CC=C2C=C3C(=CC2=C1)C(=O)C4=CC=CC=C4C3=O