N-tert-butoxycarbonyl-L-pyroglutamic acid methyl ester is a protected amino acid derivative commonly employed as a pharmaceutical intermediate. Its primary significance lies in its use for peptide synthesis, where the tert-butoxycarbonyl (Boc) group serves as a temporary protecting group for the amine functionality.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 108963-96-8
(R)-Di-tert-butyl 5-oxopyrrolidine-1,2-dicarboxylate
Pharmaceutical intermediate for peptide synthesis
Di-tert-butyl (2s)-5-oxopyrrolidine-1,2-dicarboxylate
Pharmaceutical intermediate for peptide synthesis
1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) ester, (2S)-
Boc-protected amino acid intermediate
1-(1,1-Dimethylethyl) 2-ethyl (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
Pharmaceutical intermediate for peptide synthesis
3-Hydroxypyridin
pharmaceutical intermediate
1-Methylpiperazin
Pharmaceutical intermediate and fine chemical
4-Methylmorpholine
pharmaceutical intermediate
2-Brompyridin
Intermediate for pharmaceuticals and agrochemicals
1-O-tert-butyl 2-O-methyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate
FNTAOUUEQHKLIU-ZETCQYMHSA-N
CC(C)(C)OC(=O)N1[C@@H](CCC1=O)C(=O)OC