This compound is a deuterium-labeled form of isopropylamine hydrochloride, primarily used as a research reagent. The incorporation of seven deuterium atoms makes it valuable for tracing and analytical studies in chemical and biological research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 106658-10-0
1,1,1,2,3,3,3-heptadeuteriopropan-2-amine
deuterated research compound
(S)-Ru(OAc)2(T-BINAP)
chiral catalyst for asymmetric synthesis
Isopropylmagnesium Chloride
Grignard reagent for organic synthesis
Aminomalonic acid
metabolite research reagent
(S)-morpholine-3-carboxylic acid
research compound
ISO-PROPYL-1,1,1,3,3,3-D6-AMINE
deuterated research reagent
2-Propanamine
Solvent and chemical intermediate
1,1,1,2,3,3,3-heptadeuteriopropan-2-amine;hydrochloride
ISYORFGKSZLPNW-NDCOIKGTSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])N.Cl