4-Methoxy-3-nitrobenzoyl chloride is a research reagent and chemical intermediate used primarily in organic synthesis. It features a benzoyl chloride moiety substituted with methoxy and nitro groups, making it a versatile building block for preparing more complex molecules.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 10397-28-1
4-Methyl-1-naphthaleneboronic acid
boronic acid research reagent
Para-Nitrophenylessigsäure
organic synthesis reagent
2-Hydroxy-4-(trifluoromethyl)pyrimidine
research compound
3-Methoxynaphthalene-2-boronic acid
research compound
4-methoxy-3-nitrobenzoyl chloride
FUXMQFBGQSNVBM-UHFFFAOYSA-N
COC1=C(C=C(C=C1)C(=O)Cl)[N+](=O)[O-]
—