Propyl-d7 alcohol is a deuterated research standard, specifically This compound, used as a labeled compound in analytical and laboratory research. Its significance lies in its application as an internal standard or tracer in mass spectrometry and nuclear magnetic resonance (NMR) studies due to the incorporation of seven deuterium atoms.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 102910-31-6
Allyl-d5 bromide
deuterated alkylating reagent
Magnesium chloride 3,4-dimethylbenzen-1-ide (1/1/1)
Grignard reagent for organic synthesis
1-(1-Ethoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Research compound for synthesis
N-Cyclohexyltaurine
biological buffer reagent
1-Propanol
solvent and disinfecting agent
1,1,2,2,3,3,3-heptadeuteriopropan-1-ol
BDERNNFJNOPAEC-NCKGIQLSSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])O