6-Chloro-5-nitro-1H-indazole is a chemical compound used as a pharmaceutical intermediate. It features a heterocyclic indazole core with chlorine and nitro substituents, which makes it a building block in the synthesis of more complex molecules.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 101420-98-8
Tert-butyl (3S)-3-hydroxypyrrolidine-1-carboxylate
Pharmaceutical intermediate for drug synthesis
5-Chloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid
pharmaceutical intermediate
Hydroxy Dimetridazole-d3
Pharmaceutical intermediate and reference standard
N-(2-(Dimethylamino)-3-methylbutyl)-4-(((4-methyl-2-oxo-2H-chromen-7-yl)oxy)methyl)benzamide
pharmaceutical intermediate
6-chloro-5-nitro-1H-indazole
SXVCMKGCWGVSSX-UHFFFAOYSA-N
C1=C2C=NNC2=CC(=C1[N+](=O)[O-])Cl